ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7623-11-2 2-Chlorobutyryl chloride |
|
نام محصول | 2-Chlorobutyryl chloride |
نام انگلیسی | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
میدان مغناطیسی | C4H6Cl2O |
وزن مولکولی | 140.9958 |
InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
شماره سیایاس | 7623-11-2 |
ساختار مولکولی | ![]() |
تراکم | 1.227g/cm3 |
نقطه غلیان | 130.5°C at 760 mmHg |
ضریب شکست | 1.44 |
نقطه اشتعال | 53.2°C |
فشار بخار | 9.68mmHg at 25°C |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |