Chemindex > 101-99-5
IT ▼
101-99-5 N-Phenylurethane |
|
| Nome del prodotto | N-Phenylurethane |
| Nome inglese | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
| Formula molecolare | C9H11NO2 |
| Peso Molecolare | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| Numero CAS | 101-99-5 |
| EINECS | 202-995-9 |
| Struttura molecolare |  |
| Densità | 1.136g/cm3 |
| Punto di ebollizione | 238°C at 760 mmHg |
| Indice di rifrazione | 1.558 |
| Punto d'infiammabilità | 79.2°C |
| Pressione di vapore | 0.0434mmHg at 25°C |
| Codici di Rischio | R40##Possible risks of irreversible effects.:; |
| Sicurezza Descrizione | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Il servizio di database CAS chimico è fornito da ChemIndex.com 