ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
| Nome del prodotto | 3-Hydroxyphenylacetylene |
| Nome inglese | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
| Formula molecolare | C8H6O |
| Peso Molecolare | 118.1326 |
| InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| Numero CAS | 10401-11-3 |
| Struttura molecolare | ![]() |
| Densità | 1.12g/cm3 |
| Punto di ebollizione | 230.9°C at 760 mmHg |
| Indice di rifrazione | 1.589 |
| Punto d'infiammabilità | 106.1°C |
| Pressione di vapore | 0.0424mmHg at 25°C |
| Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |