ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
116-25-6 1-(Hydroxymethyl)-5,5-dimethyl hydantoin |
|
| Nome del prodotto | 1-(Hydroxymethyl)-5,5-dimethyl hydantoin |
| Nome inglese | 1-(Hydroxymethyl)-5,5-dimethyl hydantoin;1-(Hydroxymethyl)-5,5-dimethylhydantoin;5,5-Dimethyl-1-(hydroxymethyl)hydantoin;1-(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;1-Hydroxymethyl-5,5-dimethylhydantoin;2,4-Imidazolidinedione, (hydroxymethyl)-5,5-dimethyl-;1-Hydroxymethyl-5,5-Dimethyl Hydantoin |
| Formula molecolare | C6H10N2O3 |
| Peso Molecolare | 158.1552 |
| InChI | InChI=1/C6H10N2O3/c1-6(2)4(10)7-5(11)8(6)3-9/h9H,3H2,1-2H3,(H,7,10,11) |
| Numero CAS | 116-25-6;27636-82-4 |
| EINECS | 204-132-1 |
| Struttura molecolare | ![]() |
| Densità | 1.257g/cm3 |
| Indice di rifrazione | 1.493 |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |