ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
131138-20-0 1,2,3-tricloro-5-(2,4,5-triclorofenossi)benzene |
|
| Nome del prodotto | 1,2,3-tricloro-5-(2,4,5-triclorofenossi)benzene |
| Nome inglese | 1,2,3-trichloro-5-(2,4,5-trichlorophenoxy)benzene; |
| Formula molecolare | C12H4Cl6O |
| Peso Molecolare | 376.8776 |
| InChI | InChI=1/C12H4Cl6O/c13-6-3-8(15)11(4-7(6)14)19-5-1-9(16)12(18)10(17)2-5/h1-4H |
| Numero CAS | 131138-20-0 |
| Struttura molecolare | ![]() |
| Densità | 1.626g/cm3 |
| Punto di ebollizione | 409.4°C at 760 mmHg |
| Indice di rifrazione | 1.626 |
| Punto d'infiammabilità | 147.1°C |
| Pressione di vapore | 1.54E-06mmHg at 25°C |
| MSDS | |