ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13351-02-5 1-(3-chlorophenyl)-6,6-dimethyl-1,6-dihydro-1,3,5-triazine-2,4-diamine |
|
| Nome del prodotto | 1-(3-chlorophenyl)-6,6-dimethyl-1,6-dihydro-1,3,5-triazine-2,4-diamine |
| Nome inglese | 1-(3-chlorophenyl)-6,6-dimethyl-1,6-dihydro-1,3,5-triazine-2,4-diamine; |
| Formula molecolare | C11H14ClN5 |
| Peso Molecolare | 251.7154 |
| InChI | InChI=1/C11H14ClN5/c1-11(2)16-9(13)15-10(14)17(11)8-5-3-4-7(12)6-8/h3-6H,1-2H3,(H4,13,14,15,16) |
| Numero CAS | 13351-02-5;1931-19-7 |
| Struttura molecolare | ![]() |
| Densità | 1.4g/cm3 |
| Punto di ebollizione | 400.8°C at 760 mmHg |
| Indice di rifrazione | 1.667 |
| Punto d'infiammabilità | 196.2°C |
| Pressione di vapore | 1.24E-06mmHg at 25°C |
| MSDS | |