ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13909-21-2 1-(2-chloroethyl)-3-(3-methoxyphenyl)-1-nitrosourea |
|
| Nome del prodotto | 1-(2-chloroethyl)-3-(3-methoxyphenyl)-1-nitrosourea |
| Nome inglese | 1-(2-chloroethyl)-3-(3-methoxyphenyl)-1-nitrosourea; |
| Formula molecolare | C10H12ClN3O3 |
| Peso Molecolare | 257.6736 |
| InChI | InChI=1/C10H12ClN3O3/c1-17-9-4-2-3-8(7-9)12-10(15)14(13-16)6-5-11/h2-4,7H,5-6H2,1H3,(H,12,15) |
| Numero CAS | 13909-21-2 |
| Struttura molecolare | ![]() |
| Densità | 1.32g/cm3 |
| Indice di rifrazione | 1.567 |
| MSDS | |