ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
15145-33-2 1-(2-hydroxyethyl)-3-(2-methoxyphenyl)urea |
|
| Nome del prodotto | 1-(2-hydroxyethyl)-3-(2-methoxyphenyl)urea |
| Nome inglese | 1-(2-hydroxyethyl)-3-(2-methoxyphenyl)urea; |
| Formula molecolare | C10H14N2O3 |
| Peso Molecolare | 210.2298 |
| InChI | InChI=1/C10H14N2O3/c1-15-9-5-3-2-4-8(9)12-10(14)11-6-7-13/h2-5,13H,6-7H2,1H3,(H2,11,12,14) |
| Numero CAS | 15145-33-2 |
| Struttura molecolare | ![]() |
| Densità | 1.241g/cm3 |
| Punto di ebollizione | 357.6°C at 760 mmHg |
| Indice di rifrazione | 1.587 |
| Punto d'infiammabilità | 170°C |
| Pressione di vapore | 9.83E-06mmHg at 25°C |
| MSDS | |