ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16018-83-0 1-(4-Fluorophenyl)biguanidine hydrochloride |
|
Nome del prodotto | 1-(4-Fluorophenyl)biguanidine hydrochloride |
Nome inglese | 1-(4-Fluorophenyl)biguanidine hydrochloride;1-(4-Fluorophenyl)biguanide hydrochloride |
Formula molecolare | C8H10FN5 |
Peso Molecolare | 195.19 |
InChI | InChI=1/C8H10FN5.ClH/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H |
Numero CAS | 16018-83-0 |
Struttura molecolare | ![]() |
Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |