ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2142-70-3 2-Iodoacetophenone |
|
Nome del prodotto | 2-Iodoacetophenone |
Nome inglese | 2-Iodoacetophenone;2'-iodoacetophenone;1-(2-iodophenyl)ethanone;Iodoacetophenone, 2'- |
Formula molecolare | C8H7IO |
Peso Molecolare | 246.045 |
InChI | InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
Numero CAS | 2142-70-3 |
Struttura molecolare | ![]() |
Densità | 1.72g/cm3 |
Punto di ebollizione | 268.2°C at 760 mmHg |
Indice di rifrazione | 1.603 |
Punto d'infiammabilità | 116°C |
Pressione di vapore | 0.00779mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |