ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-65-6 1-n-Butyl-4-(ethylthio)benzene |
|
| Nome del prodotto | 1-n-Butyl-4-(ethylthio)benzene |
| Nome inglese | 1-n-Butyl-4-(ethylthio)benzene;4-(Ethylthio)-n-butylbenzene;1-butyl-4-(ethylsulfanyl)benzene |
| Formula molecolare | C12H18S |
| Peso Molecolare | 194.3363 |
| InChI | InChI=1/C12H18S/c1-3-5-6-11-7-9-12(10-8-11)13-4-2/h7-10H,3-6H2,1-2H3 |
| Numero CAS | 216393-65-6 |
| Struttura molecolare | ![]() |
| Densità | 0.96g/cm3 |
| Punto di ebollizione | 279.6°C at 760 mmHg |
| Indice di rifrazione | 1.53 |
| Punto d'infiammabilità | 119.8°C |
| Pressione di vapore | 0.00675mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |