ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23132-21-0 2-Bromo-3-methyl-5-nitropyridine |
|
| Nome del prodotto | 2-Bromo-3-methyl-5-nitropyridine |
| Nome inglese | 2-Bromo-3-methyl-5-nitropyridine;2-Bromo-5-nitro-3-picoline |
| Formula molecolare | C6H5BrN2O2 |
| Peso Molecolare | 217.0201 |
| InChI | InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| Numero CAS | 23132-21-0 |
| Struttura molecolare | ![]() |
| Densità | 1.709g/cm3 |
| Punto di ebollizione | 305.1°C at 760 mmHg |
| Indice di rifrazione | 1.599 |
| Punto d'infiammabilità | 138.3°C |
| Pressione di vapore | 0.00151mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |