ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride |
|
| Nome del prodotto | 2-chloro-6-methylpyridine-4-carbonyl chloride |
| Nome inglese | 2-chloro-6-methylpyridine-4-carbonyl chloride; |
| Formula molecolare | C7H5Cl2NO |
| Peso Molecolare | 190.0267 |
| InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
| Numero CAS | 26413-58-1 |
| Struttura molecolare | ![]() |
| Densità | 1.384g/cm3 |
| Punto di ebollizione | 270.3°C at 760 mmHg |
| Indice di rifrazione | 1.558 |
| Punto d'infiammabilità | 117.3°C |
| Pressione di vapore | 0.00688mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |