ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29886-67-7 4-tiofene-3-ilfenolo |
|
| Nome del prodotto | 4-tiofene-3-ilfenolo |
| Nome inglese | 4-thiophen-3-ylphenol; |
| Formula molecolare | C10H8OS |
| Peso Molecolare | 176.2349 |
| InChI | InChI=1/C10H8OS/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-7,11H |
| Numero CAS | 29886-67-7 |
| Struttura molecolare | ![]() |
| Densità | 1.235g/cm3 |
| Punto di ebollizione | 276.8°C at 760 mmHg |
| Indice di rifrazione | 1.635 |
| Punto d'infiammabilità | 121.2°C |
| Pressione di vapore | 0.00279mmHg at 25°C |
| MSDS | |