ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30289-02-2 (dimethylamino)({[(1Z)-1-(3-methoxyphenyl)ethylidene]amino}oxy)methanone |
|
| Nome del prodotto | (dimethylamino)({[(1Z)-1-(3-methoxyphenyl)ethylidene]amino}oxy)methanone |
| Nome inglese | (dimethylamino)({[(1Z)-1-(3-methoxyphenyl)ethylidene]amino}oxy)methanone; |
| Formula molecolare | C12H16N2O3 |
| Peso Molecolare | 236.267 |
| InChI | InChI=1/C12H16N2O3/c1-9(13-17-12(15)14(2)3)10-6-5-7-11(8-10)16-4/h5-8H,1-4H3/b13-9- |
| Numero CAS | 30289-02-2 |
| Struttura molecolare | ![]() |
| Densità | 1.076g/cm3 |
| Punto di ebollizione | 330.192°C at 760 mmHg |
| Indice di rifrazione | 1.506 |
| Punto d'infiammabilità | 153.495°C |
| Pressione di vapore | 0mmHg at 25°C |
| MSDS | |