ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
320-65-0 2-fluorobenzal chloride |
|
| Nome del prodotto | 2-fluorobenzal chloride |
| Nome inglese | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
| Formula molecolare | C7H5Cl2F |
| Peso Molecolare | 179.02 |
| InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
| Numero CAS | 320-65-0 |
| EINECS | 206-279-7 |
| Struttura molecolare | ![]() |
| Densità | 1.3 |
| Punto di ebollizione | 224℃ |
| Codici di Rischio | R34##Causes burns.||R36##Irritating to eyes.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |