ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
Nome del prodotto | Monoethylpimelate |
Nome inglese | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
Formula molecolare | C9H16O4 |
Peso Molecolare | 188.2209 |
InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
Numero CAS | 33018-91-6 |
EINECS | 251-346-6 |
Struttura molecolare | ![]() |
Densità | 1.074g/cm3 |
Punto di ebollizione | 288.7°C at 760 mmHg |
Indice di rifrazione | 1.449 |
Punto d'infiammabilità | 108°C |
Pressione di vapore | 0.000581mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |