ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
| Nome del prodotto | 3-fluoro-4-methoxybenzonitrile |
| Nome inglese | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
| Formula molecolare | C8H6FNO |
| Peso Molecolare | 151.1377 |
| InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| Numero CAS | 331-62-4 |
| Struttura molecolare | ![]() |
| Densità | 1.18g/cm3 |
| Punto di ebollizione | 254.3°C at 760 mmHg |
| Indice di rifrazione | 1.505 |
| Punto d'infiammabilità | 107.6°C |
| Pressione di vapore | 0.0173mmHg at 25°C |
| Codici di Rischio | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sicurezza Descrizione | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |