ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-43-4 1-(2-chloroethyl)-4-fluorobenzene |
|
| Nome del prodotto | 1-(2-chloroethyl)-4-fluorobenzene |
| Nome inglese | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
| Formula molecolare | C8H8ClF |
| Peso Molecolare | 158.6005 |
| InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
| Numero CAS | 332-43-4 |
| EINECS | 206-364-9 |
| Struttura molecolare | ![]() |
| Densità | 1.15g/cm3 |
| Punto di ebollizione | 204.6°C at 760 mmHg |
| Indice di rifrazione | 1.501 |
| Punto d'infiammabilità | 79.9°C |
| Pressione di vapore | 0.373mmHg at 25°C |
| Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |