ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34098-18-5 3-Chloro-4,5-dihydroxybenzaldehyde |
|
| Nome del prodotto | 3-Chloro-4,5-dihydroxybenzaldehyde |
| Nome inglese | 3-Chloro-4,5-dihydroxybenzaldehyde;benzaldehyde, 3-chloro-4,5-dihydroxy- |
| Formula molecolare | C7H5ClO3 |
| Peso Molecolare | 172.5658 |
| InChI | InChI=1/C7H5ClO3/c8-5-1-4(3-9)2-6(10)7(5)11/h1-3,10-11H |
| Numero CAS | 34098-18-5 |
| Struttura molecolare | ![]() |
| Densità | 1.57g/cm3 |
| Punto di ebollizione | 290.7°C at 760 mmHg |
| Indice di rifrazione | 1.682 |
| Punto d'infiammabilità | 129.6°C |
| Pressione di vapore | 0.00117mmHg at 25°C |
| MSDS | |