ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
343-27-1 Harmine hydrochloride hydrate | 
    |
| Nome del prodotto | Harmine hydrochloride hydrate | 
| Nome inglese | Harmine hydrochloride hydrate;7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate;Harmine hydrochlorid;Banisterine, Telepathine;7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride;Harmine Hydrochloride | 
| Formula molecolare | C13H13ClN2O | 
| Peso Molecolare | 248.7081 | 
| InChI | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H | 
| Numero CAS | 343-27-1 | 
| EINECS | 206-443-8 | 
| Struttura molecolare | ![]()  | 
    
| Punto di fusione | 265-270℃ | 
| Punto di ebollizione | 421.4°C at 760 mmHg | 
| Punto d'infiammabilità | 139.8°C | 
| Pressione di vapore | 6.42E-07mmHg at 25°C | 
| Simboli di pericolo | |
| Codici di Rischio | R40##Possible risks of irreversible effects.:; | 
    
| Sicurezza Descrizione | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |