ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35554-44-0 Enilconazole |
|
| Nome del prodotto | Enilconazole |
| Nome inglese | Enilconazole;Imazalil;1-[2-(2,4-Dichloro-phenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole;1-[2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole;1-[2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole;1-[2-(2,4-dichlorophenyl)-2-prop-2-enoxyethyl]imidazole;1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole |
| Formula molecolare | C14H14Cl2N2O |
| Peso Molecolare | 297.18 |
| InChI | InChI=1/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2 |
| Numero CAS | 35554-44-0;73790-28-0 |
| EINECS | 252-615-0 |
| Struttura molecolare | ![]() |
| Densità | 1.348 |
| Punto di fusione | 52.7℃ |
| Punto di ebollizione | >340℃ |
| Solubilità in acqua | 0.018 g/100 mL |
| MSDS | |