ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35657-37-5 (aminooxy)(4-nitrophenyl)methanone |
|
| Nome del prodotto | (aminooxy)(4-nitrophenyl)methanone |
| Nome inglese | (aminooxy)(4-nitrophenyl)methanone; |
| Formula molecolare | C7H6N2O4 |
| Peso Molecolare | 182.1335 |
| InChI | InChI=1/C7H6N2O4/c8-13-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,8H2 |
| Numero CAS | 35657-37-5 |
| Struttura molecolare | ![]() |
| Densità | 1.441g/cm3 |
| Punto di ebollizione | 361.4°C at 760 mmHg |
| Indice di rifrazione | 1.604 |
| Punto d'infiammabilità | 172.4°C |
| Pressione di vapore | 2.07E-05mmHg at 25°C |
| MSDS | |