ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 39828-35-8 2,4- dimethoxybenzoyl chloride | |
| Nome del prodotto | 2,4- dimethoxybenzoyl chloride | 
| Nome inglese | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- | 
| Formula molecolare | C9H9ClO3 | 
| Peso Molecolare | 200.619 | 
| InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 | 
| Numero CAS | 39828-35-8 | 
| Struttura molecolare |  | 
| Densità | 1.224g/cm3 | 
| Punto di fusione | 58℃ | 
| Punto di ebollizione | 306.7°C at 760 mmHg | 
| Indice di rifrazione | 1.52 | 
| Punto d'infiammabilità | 134.1°C | 
| Pressione di vapore | 0.000757mmHg at 25°C | 
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; | 
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |