ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
| Nome del prodotto | 1-(3-fluorophenyl)ethanol |
| Nome inglese | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
| Formula molecolare | C8H9FO |
| Peso Molecolare | 140.1549 |
| InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| Numero CAS | 402-63-1 |
| EINECS | 206-950-4 |
| Struttura molecolare | ![]() |
| Densità | 1.123g/cm3 |
| Punto di ebollizione | 196.2°C at 760 mmHg |
| Indice di rifrazione | 1.51 |
| Punto d'infiammabilità | 90.1°C |
| Pressione di vapore | 0.251mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |