ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-53-0 1,2-Dihydronaphthalene |
|
| Nome del prodotto | 1,2-Dihydronaphthalene |
| Nome inglese | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
| Formula molecolare | C10H10 |
| Peso Molecolare | 130.1864 |
| InChI | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| Numero CAS | 447-53-0 |
| EINECS | 207-183-8 |
| Struttura molecolare | ![]() |
| Densità | 1.004g/cm3 |
| Punto di fusione | -8℃ |
| Punto di ebollizione | 204.9°C at 760 mmHg |
| Indice di rifrazione | 1.572 |
| Punto d'infiammabilità | 70.4°C |
| Pressione di vapore | 0.367mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |