ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
| Nome del prodotto | 1-(3-fluorophenyl)-2-thiourea |
| Nome inglese | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
| Formula molecolare | C7H7FN2S |
| Peso Molecolare | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Numero CAS | 458-05-9 |
| Struttura molecolare | ![]() |
| Densità | 1.397g/cm3 |
| Punto di ebollizione | 259.3°C at 760 mmHg |
| Indice di rifrazione | 1.692 |
| Punto d'infiammabilità | 110.6°C |
| Pressione di vapore | 0.0131mmHg at 25°C |
| Codici di Rischio | R25##Toxic if swallowed.:; |
| Sicurezza Descrizione | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |