ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
467425-85-0 1,3-bis(1-idrossi-2,2-dimetossi-etil)urea |
|
| Nome del prodotto | 1,3-bis(1-idrossi-2,2-dimetossi-etil)urea |
| Sinonimi | 1,3-bis(1-idrossi-2,2-dimetossietil)urea; urea, N,N'-bis(1-idrossi-2,2-dimetossietil)- |
| Nome inglese | 1,3-bis(1-hydroxy-2,2-dimethoxy-ethyl)urea;1,3-Bis(1-hydroxy-2,2-dimethoxyethyl)urea;urea, N,N'-bis(1-hydroxy-2,2-dimethoxyethyl)- |
| Formula molecolare | C9H20N2O7 |
| Peso Molecolare | 268.26 |
| InChI | InChI=1/C9H20N2O7/c1-15-7(16-2)5(12)10-9(14)11-6(13)8(17-3)18-4/h5-8,12-13H,1-4H3,(H2,10,11,14) |
| Numero CAS | 467425-85-0 |
| Struttura molecolare | ![]() |
| Densità | 1.254g/cm3 |
| Punto di ebollizione | 483.8°C at 760 mmHg |
| Indice di rifrazione | 1.481 |
| Punto d'infiammabilità | 246.4°C |
| Pressione di vapore | 2.16E-11mmHg at 25°C |
| MSDS | |