ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde |
|
| Nome del prodotto | 2-Carboxy-3,4-dimethoxybenzaldehyde |
| Nome inglese | 2-Carboxy-3,4-dimethoxybenzaldehyde;5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid;6-formyl-2,3-dimethoxybenzoic acid |
| Formula molecolare | C10H10O5 |
| Peso Molecolare | 210.1834 |
| InChI | InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
| Numero CAS | 519-05-1 |
| EINECS | 208-261-4 |
| Struttura molecolare | ![]() |
| Densità | 1.3g/cm3 |
| Punto di ebollizione | 386.3°C at 760 mmHg |
| Indice di rifrazione | 1.573 |
| Punto d'infiammabilità | 155.1°C |
| Pressione di vapore | 1.17E-06mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |