ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5444-08-6 6-[(4-methylphenyl)sulfanyl]-5H-purine |
|
| Nome del prodotto | 6-[(4-methylphenyl)sulfanyl]-5H-purine |
| Nome inglese | 6-[(4-methylphenyl)sulfanyl]-5H-purine; |
| Formula molecolare | C12H10N4S |
| Peso Molecolare | 242.2996 |
| InChI | InChI=1/C12H10N4S/c1-8-2-4-9(5-3-8)17-12-10-11(14-6-13-10)15-7-16-12/h2-7,10H,1H3 |
| Numero CAS | 5444-08-6 |
| Struttura molecolare | ![]() |
| Densità | 1.4g/cm3 |
| Punto di ebollizione | 401.7°C at 760 mmHg |
| Indice di rifrazione | 1.745 |
| Punto d'infiammabilità | 196.8°C |
| Pressione di vapore | 2.68E-06mmHg at 25°C |
| MSDS | |