ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5486-62-4 2-(aziridina-1-il)but-3-en-1-il fenilcarbammato |
|
| Nome del prodotto | 2-(aziridina-1-il)but-3-en-1-il fenilcarbammato |
| Nome inglese | 2-(aziridin-1-yl)but-3-en-1-yl phenylcarbamate; |
| Formula molecolare | C13H16N2O2 |
| Peso Molecolare | 232.2783 |
| InChI | InChI=1/C13H16N2O2/c1-2-12(15-8-9-15)10-17-13(16)14-11-6-4-3-5-7-11/h2-7,12H,1,8-10H2,(H,14,16) |
| Numero CAS | 5486-62-4 |
| Struttura molecolare | ![]() |
| Densità | 1.21g/cm3 |
| Punto di ebollizione | 312.5°C at 760 mmHg |
| Indice di rifrazione | 1.61 |
| Punto d'infiammabilità | 142.8°C |
| Pressione di vapore | 0.000526mmHg at 25°C |
| MSDS | |