ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2394-20-9 VMA |
|
| Nome del prodotto | VMA |
| Nome inglese | VMA;4-Hydroxy-3-methoxymandelic acid;DL-3-Methoxy-4-hydroxymandelic acid DL-4-Hydroxy-3-methoxy mandelic acid;hydroxy(4-hydroxy-3-methoxyphenyl)acetic acid;Vanillylmandelic acid |
| Formula molecolare | C9H10O5 |
| Peso Molecolare | 198.1727 |
| InChI | InChI=1/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) |
| Numero CAS | 2394-20-9;55-10-7 |
| EINECS | 200-224-0 |
| Struttura molecolare | ![]() |
| Densità | 1.44g/cm3 |
| Punto di fusione | 131-134℃ |
| Punto di ebollizione | 421.3°C at 760 mmHg |
| Indice di rifrazione | 1.606 |
| Punto d'infiammabilità | 173.7°C |
| Pressione di vapore | 7.5E-08mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |