ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55242-86-9 N~2~-[2-(diethylamino)ethyl]-4-phenyl-1,8-naphthyridine-2,7-diamine |
|
| Nome del prodotto | N~2~-[2-(diethylamino)ethyl]-4-phenyl-1,8-naphthyridine-2,7-diamine |
| Nome inglese | N~2~-[2-(diethylamino)ethyl]-4-phenyl-1,8-naphthyridine-2,7-diamine; |
| Formula molecolare | C20H25N5 |
| Peso Molecolare | 335.446 |
| InChI | InChI=1/C20H25N5/c1-3-25(4-2)13-12-22-19-14-17(15-8-6-5-7-9-15)16-10-11-18(21)23-20(16)24-19/h5-11,14H,3-4,12-13H2,1-2H3,(H3,21,22,23,24) |
| Numero CAS | 55242-86-9 |
| Struttura molecolare | ![]() |
| Densità | 1.169g/cm3 |
| Punto di ebollizione | 539.2°C at 760 mmHg |
| Indice di rifrazione | 1.657 |
| Punto d'infiammabilità | 279.9°C |
| Pressione di vapore | 1.08E-11mmHg at 25°C |
| MSDS | |