ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-56-4 3,5-Diaminobenzoic acid dihydrochloride | 
    |
| Nome del prodotto | 3,5-Diaminobenzoic acid dihydrochloride | 
| Nome inglese | 3,5-Diaminobenzoic acid dihydrochloride;Benzoic acid, 3,5-diamino-, hydrochloride (1:2);AI3-51087;NSC 57806;Benzoic acid, 3,5-diamino-, dihydrochloride | 
| Formula molecolare | C7H8N2O2.2HCl | 
| Peso Molecolare | 225.07 | 
| InChI | InChI=1/C7H8N2O2.2ClH/c8-5-1-4(7(10)11)2-6(9)3-5;;/h1-3H,8-9H2,(H,10,11);2*1H | 
| Numero CAS | 618-56-4 | 
| EINECS | 210-556-8 | 
| Struttura molecolare | ![]()  | 
    
| Punto di fusione | 300℃ | 
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |