ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-76-8 4-hydroxy-3,5-diiodobenzoic acid | |
| Nome del prodotto | 4-hydroxy-3,5-diiodobenzoic acid | 
| Nome inglese | 4-hydroxy-3,5-diiodobenzoic acid;3,5-Diiodo-4-hydroxybenzoic acid | 
| Formula molecolare | C7H4I2O3 | 
| Peso Molecolare | 389.9138 | 
| InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) | 
| Numero CAS | 618-76-8 | 
| EINECS | 210-562-0 | 
| Struttura molecolare |  | 
| Densità | 2.697g/cm3 | 
| Punto di ebollizione | 346.4°C at 760 mmHg | 
| Indice di rifrazione | 1.784 | 
| Punto d'infiammabilità | 163.3°C | 
| Pressione di vapore | 2.19E-05mmHg at 25°C | 
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
| MSDS | |