ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6282-00-4 NN-Dipropylformamide |
|
Nome del prodotto | NN-Dipropylformamide |
Nome inglese | NN-Dipropylformamide;N,N-Di-n-propylformamide;N,N-dipropylformamide |
Formula molecolare | C7H15NO |
Peso Molecolare | 129.2001 |
InChI | InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
Numero CAS | 6282-00-4 |
Struttura molecolare | ![]() |
Densità | 0.869g/cm3 |
Punto di ebollizione | 221.3°C at 760 mmHg |
Indice di rifrazione | 1.429 |
Punto d'infiammabilità | 83.7°C |
Pressione di vapore | 0.108mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |