Chemindex > 68411-40-5
IT ▼
68411-40-5 Benzene, 1,2-dimethyl-, reaction products with styrene |
|
| Nome del prodotto | Benzene, 1,2-dimethyl-, reaction products with styrene |
| Nome inglese | Benzene, 1,2-dimethyl-, reaction products with styrene;Distyrylxylene;1,2-dimethylbenzene - ethenylbenzene (1:1) |
| Formula molecolare | C16H18 |
| Peso Molecolare | 210.3141 |
| InChI | InChI=1/C8H10.C8H8/c1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-7H,1H2 |
| Numero CAS | 68411-40-5 |
| EINECS | 270-121-3 |
| Struttura molecolare |  |
| Punto di ebollizione | 145.9°C at 760 mmHg |
| Punto d'infiammabilità | 29.2°C |
| Pressione di vapore | 5.99mmHg at 25°C |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Fornitori per 68411-40-5 (0):
Il servizio di database CAS chimico è fornito da ChemIndex.com 