ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70-57-5 5-Methylnicotinamide |
|
| Nome del prodotto | 5-Methylnicotinamide |
| Nome inglese | 5-Methylnicotinamide;5-Methylpyridine-3-carboxamide |
| Formula molecolare | C7H8N2O |
| Peso Molecolare | 136.1512 |
| InChI | InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
| Numero CAS | 70-57-5 |
| Struttura molecolare | ![]() |
| Densità | 1.157g/cm3 |
| Punto di ebollizione | 290°C at 760 mmHg |
| Indice di rifrazione | 1.561 |
| Punto d'infiammabilità | 129.2°C |
| Pressione di vapore | 0.00213mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |