ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72437-56-0 3-methyl-1-(methyldisulfanyl)butane |
|
| Nome del prodotto | 3-methyl-1-(methyldisulfanyl)butane |
| Nome inglese | 3-methyl-1-(methyldisulfanyl)butane;3-Methyl-1-(methyldisulfanyl)butane;Disulfide, isopentyl methyl;disulfide, methyl 3-methylbutyl;Methyl 3-methylbutyl disulfide;Methyl isopentyl disulphide |
| Formula molecolare | C6H14S2 |
| Peso Molecolare | 150.3054 |
| InChI | InChI=1/C6H14S2/c1-6(2)4-5-8-7-3/h6H,4-5H2,1-3H3 |
| Numero CAS | 72437-56-0 |
| Struttura molecolare | ![]() |
| Densità | 0.964g/cm3 |
| Punto di ebollizione | 184.5°C at 760 mmHg |
| Indice di rifrazione | 1.499 |
| Punto d'infiammabilità | 56.9°C |
| Pressione di vapore | 1mmHg at 25°C |
| MSDS | |