ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74940-27-5 [butyl(nitroso)amino]methyl hydroperoxide |
|
| Nome del prodotto | [butyl(nitroso)amino]methyl hydroperoxide |
| Nome inglese | [butyl(nitroso)amino]methyl hydroperoxide; |
| Formula molecolare | C5H12N2O3 |
| Peso Molecolare | 148.1604 |
| InChI | InChI=1/C5H12N2O3/c1-2-3-4-7(6-8)5-10-9/h9H,2-5H2,1H3 |
| Numero CAS | 74940-27-5 |
| Struttura molecolare | ![]() |
| Densità | 1.15g/cm3 |
| Punto di ebollizione | 316.9°C at 760 mmHg |
| Indice di rifrazione | 1.464 |
| Punto d'infiammabilità | 145.5°C |
| Pressione di vapore | 3.34E-05mmHg at 25°C |
| MSDS | |