ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75531-55-4 10-etossi-1,5,10-trimetilciclododecadiene |
|
| Nome del prodotto | 10-etossi-1,5,10-trimetilciclododecadiene |
| Sinonimi | 10-etossi-1,5,10-trimetilciclododecadiene; (1Z,3E)-10-etossi-1,5,10-trimetilciclododeca-1,3-diene; |
| Nome inglese | 10-ethoxy-1,5,10-trimethylcyclododecadiene;10-Ethoxy-1,5,10-trimethylcyclododecadiene;(1Z,3E)-10-ethoxy-1,5,10-trimethylcyclododeca-1,3-diene |
| Formula molecolare | C17H30O |
| Peso Molecolare | 250.4195 |
| InChI | InChI=1/C17H30O/c1-5-18-17(4)13-7-6-9-15(2)10-8-11-16(3)12-14-17/h8,10-11,15H,5-7,9,12-14H2,1-4H3/b10-8+,16-11- |
| Numero CAS | 75531-55-4 |
| EINECS | 278-244-4 |
| Struttura molecolare | ![]() |
| Densità | 0.88g/cm3 |
| Punto di ebollizione | 324.3°C at 760 mmHg |
| Indice di rifrazione | 1.476 |
| Punto d'infiammabilità | 146°C |
| Pressione di vapore | 0.000468mmHg at 25°C |
| MSDS | |