ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77791-37-8 1-(2-{[1-(2,4-dimethylphenoxy)propan-2-yl](ethyl)amino}-2-oxoethyl)-2-methylpiperidinium chloride |
|
| Nome del prodotto | 1-(2-{[1-(2,4-dimethylphenoxy)propan-2-yl](ethyl)amino}-2-oxoethyl)-2-methylpiperidinium chloride |
| Nome inglese | 1-(2-{[1-(2,4-dimethylphenoxy)propan-2-yl](ethyl)amino}-2-oxoethyl)-2-methylpiperidinium chloride; |
| Formula molecolare | C21H35ClN2O2 |
| Peso Molecolare | 382.9678 |
| InChI | InChI=1/C21H34N2O2.ClH/c1-6-23(21(24)14-22-12-8-7-9-18(22)4)19(5)15-25-20-11-10-16(2)13-17(20)3;/h10-11,13,18-19H,6-9,12,14-15H2,1-5H3;1H |
| Numero CAS | 77791-37-8 |
| Struttura molecolare | ![]() |
| Punto di ebollizione | 471.4°C at 760 mmHg |
| Punto d'infiammabilità | 238.9°C |
| Pressione di vapore | 4.66E-09mmHg at 25°C |
| MSDS | |