ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
836-43-1 4-Benzyloxybenzyl alcohol |
|
Nome del prodotto | 4-Benzyloxybenzyl alcohol |
Nome inglese | 4-Benzyloxybenzyl alcohol;p-benzyloxybenzyl chloride |
Formula molecolare | C14H14O2 |
Peso Molecolare | 214.26 |
InChI | InChI=1/C14H14O2/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9,15H,10-11H2 |
Numero CAS | 836-43-1 |
EINECS | 212-649-9 |
Struttura molecolare | ![]() |
Punto di fusione | 84-87℃ |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |