ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-02-9 5,6-Benzoquinoline |
|
| Nome del prodotto | 5,6-Benzoquinoline |
| Nome inglese | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
| Formula molecolare | C13H9N |
| Peso Molecolare | 179.2173 |
| InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| Numero CAS | 85-02-9 |
| EINECS | 201-582-0 |
| Struttura molecolare | ![]() |
| Densità | 1.187g/cm3 |
| Punto di fusione | 89-91℃ |
| Punto di ebollizione | 350.4°C at 760 mmHg |
| Indice di rifrazione | 1.726 |
| Punto d'infiammabilità | 155.9°C |
| Pressione di vapore | 8.89E-05mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |