ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-19-8 5-chloro-2-hydroxybenzophenone |
|
| Nome del prodotto | 5-chloro-2-hydroxybenzophenone |
| Nome inglese | 5-chloro-2-hydroxybenzophenone;Benzophenone-7;(5-chloro-2-hydroxyphenyl)(phenyl)methanone |
| Formula molecolare | C13H9ClO2 |
| Peso Molecolare | 232.6624 |
| InChI | InChI=1/C13H9ClO2/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8,15H |
| Numero CAS | 85-19-8 |
| EINECS | 201-592-5 |
| Struttura molecolare | ![]() |
| Densità | 1.307g/cm3 |
| Punto di fusione | 96-98℃ |
| Punto di ebollizione | 355.5°C at 760 mmHg |
| Indice di rifrazione | 1.623 |
| Punto d'infiammabilità | 168.8°C |
| Pressione di vapore | 1.52E-05mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38:; |
| Sicurezza Descrizione | S26||S37/39:; |
| MSDS | |