ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
855-97-0 3',4',5,7-Tetramethoxyflavone |
|
| Nome del prodotto | 3',4',5,7-Tetramethoxyflavone |
| Nome inglese | 3',4',5,7-Tetramethoxyflavone;Luteolin tetramethyl ether;2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
| Formula molecolare | C19H18O6 |
| Peso Molecolare | 342.3426 |
| InChI | InChI=1/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
| Numero CAS | 855-97-0 |
| Struttura molecolare | ![]() |
| Densità | 1.243g/cm3 |
| Punto di ebollizione | 528.8°C at 760 mmHg |
| Indice di rifrazione | 1.574 |
| Punto d'infiammabilità | 233.9°C |
| Pressione di vapore | 2.86E-11mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |