ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-73-0 D-saccharic acid calcium tetrahydrate |
|
| Nome del prodotto | D-saccharic acid calcium tetrahydrate |
| Nome inglese | D-saccharic acid calcium tetrahydrate;D-glucaric acid;saccharic acid;Glucarate |
| Formula molecolare | C6H10O8 |
| Peso Molecolare | 210.1388 |
| InChI | InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 |
| Numero CAS | 87-73-0 |
| EINECS | 201-768-1 |
| Struttura molecolare | ![]() |
| Densità | 1.939g/cm3 |
| Punto di ebollizione | 766.4°C at 760 mmHg |
| Indice di rifrazione | 1.638 |
| Punto d'infiammabilità | 431.2°C |
| Pressione di vapore | 4.04E-27mmHg at 25°C |
| MSDS | |