ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88076-27-1 3-metil-1,2-dinitrofenantrene |
|
| Nome del prodotto | 3-metil-1,2-dinitrofenantrene |
| Nome inglese | 3-methyl-1,2-dinitrophenanthrene; |
| Formula molecolare | C15H10N2O4 |
| Peso Molecolare | 282.2509 |
| InChI | InChI=1/C15H10N2O4/c1-9-8-13-11-5-3-2-4-10(11)6-7-12(13)15(17(20)21)14(9)16(18)19/h2-8H,1H3 |
| Numero CAS | 88076-27-1 |
| Struttura molecolare | ![]() |
| Densità | 1.428g/cm3 |
| Punto di ebollizione | 515.9°C at 760 mmHg |
| Indice di rifrazione | 1.741 |
| Punto d'infiammabilità | 261.6°C |
| Pressione di vapore | 3.07E-10mmHg at 25°C |
| MSDS | |