ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93739-18-5 S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate) |
|
| Nome del prodotto | S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate) |
| Nome inglese | S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate); |
| Formula molecolare | C10H16N2O4S2 |
| Peso Molecolare | 292.375 |
| InChI | InChI=1/C10H16N2O4S2/c1-7(13)11-3-5-17-9(15)10(16)18-6-4-12-8(2)14/h3-6H2,1-2H3,(H,11,13)(H,12,14) |
| Numero CAS | 93739-18-5 |
| Struttura molecolare | ![]() |
| Densità | 1.284g/cm3 |
| Punto di ebollizione | 570.2°C at 760 mmHg |
| Indice di rifrazione | 1.542 |
| Punto d'infiammabilità | 298.6°C |
| Pressione di vapore | 5.18E-13mmHg at 25°C |
| MSDS | |