ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
955-59-9 2-[(2,4-dinitrophenyl)disulfanyl]ethanol |
|
| Nome del prodotto | 2-[(2,4-dinitrophenyl)disulfanyl]ethanol |
| Nome inglese | 2-[(2,4-dinitrophenyl)disulfanyl]ethanol;Ethanol, 2-((2,4-dinitrophenyl)dithio)- |
| Formula molecolare | C8H8N2O5S2 |
| Peso Molecolare | 276.2895 |
| InChI | InChI=1/C8H8N2O5S2/c11-3-4-16-17-8-2-1-6(9(12)13)5-7(8)10(14)15/h1-2,5,11H,3-4H2 |
| Numero CAS | 955-59-9 |
| Struttura molecolare | ![]() |
| Densità | 1.6g/cm3 |
| Punto di ebollizione | 439.9°C at 760 mmHg |
| Indice di rifrazione | 1.687 |
| Punto d'infiammabilità | 219.8°C |
| Pressione di vapore | 1.63E-08mmHg at 25°C |
| MSDS | |